C23H26N6O4S — CID 142498504
[(2S)-1-[4-[[5-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]methanol (PubChem CID 142498504) has the molecular formula C23H26N6O4S and a molecular weight of 482.57 g/mol. Its IUPAC name is [(2S)-1-[4-[[5-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[4-[[5-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 142498504 |
| Molecular Formula | C23H26N6O4S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | [(2S)-1-[4-[[5-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]methanol |
| SMILES | COc1cc(-c2cnc(Nc3nc(N4CCC[C@H]4CO)nn4cccc34)s2)cc(OC)c1OC |
| InChI | InChI=1S/C23H26N6O4S/c1-31-17-10-14(11-18(32-2)20(17)33-3)19-12-24-23(34-19)26-21-16-7-5-9-29(16)27-22(25-21)28-8-4-6-15(28)13-30/h5,7,9-12,15,30H,4,6,8,13H2,1-3H3,(H,24,25,26,27)/t15-/m0/s1 |
| InChIKey | CAPRKWGEODECDT-HNNXBMFYSA-N |
| XLogP | 3.58 |
| TPSA | 106.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |