About (NZ)-N'-methyl-N-(3-methylbut-3-en-2-ylidene)carbamimidoyl chloride
(NZ)-N'-methyl-N-(3-methylbut-3-en-2-ylidene)carbamimidoyl chloride (PubChem CID 142498627) has the molecular formula C7H11ClN2
and a molecular weight of 158.63 g/mol. Its IUPAC name is (NZ)-N'-methyl-N-(3-methylbut-3-en-2-ylidene)carbamimidoyl chloride.
Molecular Properties
| Compound Name | (NZ)-N'-methyl-N-(3-methylbut-3-en-2-ylidene)carbamimidoyl chloride |
| PubChem CID | 142498627 |
| Molecular Formula | C7H11ClN2 |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | (NZ)-N'-methyl-N-(3-methylbut-3-en-2-ylidene)carbamimidoyl chloride |
| SMILES | C=C(C)/C(C)=N\C(Cl)=N\C |
| InChI | InChI=1S/C7H11ClN2/c1-5(2)6(3)10-7(8)9-4/h1H2,2-4H3/b9-7+,10-6- |
| InChIKey | IBCMSRPXZICPHV-BVCWLXBRSA-N |
| XLogP | 2.25 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N'-methyl-N-(3-methylbut-3-en-2-ylidene)carbamimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N'-methyl-N-(3-methylbut-3-en-2-ylidene)carbamimidoyl chloride?
The IUPAC name of (NZ)-N'-methyl-N-(3-methylbut-3-en-2-ylidene)carbamimidoyl chloride (CID 142498627) is (NZ)-N'-methyl-N-(3-methylbut-3-en-2-ylidene)carbamimidoyl chloride.
What is the SMILES notation for (NZ)-N'-methyl-N-(3-methylbut-3-en-2-ylidene)carbamimidoyl chloride?
The canonical SMILES for (NZ)-N'-methyl-N-(3-methylbut-3-en-2-ylidene)carbamimidoyl chloride is C=C(C)/C(C)=N\C(Cl)=N\C.
What is the InChIKey of (NZ)-N'-methyl-N-(3-methylbut-3-en-2-ylidene)carbamimidoyl chloride?
The InChIKey is IBCMSRPXZICPHV-BVCWLXBRSA-N. The full InChI is InChI=1S/C7H11ClN2/c1-5(2)6(3)10-7(8)9-4/h1H2,2-4H3/b9-7+,10-6-.
What are the key properties of (NZ)-N'-methyl-N-(3-methylbut-3-en-2-ylidene)carbamimidoyl chloride?
(NZ)-N'-methyl-N-(3-methylbut-3-en-2-ylidene)carbamimidoyl chloride has a molecular weight of 158.63 g/mol, XLogP of 2.25, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N'-methyl-N-(3-methylbut-3-en-2-ylidene)carbamimidoyl chloride is sourced from PubChem (CID 142498627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).