About N-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazol-4-amine
N-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazol-4-amine (PubChem CID 142498639) has the molecular formula C22H21N3O3
and a molecular weight of 375.43 g/mol. Its IUPAC name is N-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazol-4-amine.
Molecular Properties
| Compound Name | N-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazol-4-amine |
| PubChem CID | 142498639 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazol-4-amine |
| SMILES | COc1cc(-n2cnc(Nc3ccc4ccccc4c3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H21N3O3/c1-26-19-11-18(12-20(27-2)22(19)28-3)25-13-21(23-14-25)24-17-9-8-15-6-4-5-7-16(15)10-17/h4-14,24H,1-3H3 |
| InChIKey | DJBAGBRGQWESGI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazol-4-amine?
The IUPAC name of N-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazol-4-amine (CID 142498639) is N-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazol-4-amine.
What is the SMILES notation for N-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazol-4-amine?
The canonical SMILES for N-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazol-4-amine is COc1cc(-n2cnc(Nc3ccc4ccccc4c3)c2)cc(OC)c1OC.
What is the InChIKey of N-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazol-4-amine?
The InChIKey is DJBAGBRGQWESGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O3/c1-26-19-11-18(12-20(27-2)22(19)28-3)25-13-21(23-14-25)24-17-9-8-15-6-4-5-7-16(15)10-17/h4-14,24H,1-3H3.
What are the key properties of N-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazol-4-amine?
N-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazol-4-amine has a molecular weight of 375.43 g/mol, XLogP of 4.79, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazol-4-amine is sourced from PubChem (CID 142498639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).