C23H27ClN6O4 — CID 142498700
1-[2-chloro-4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]pentan-1-ol (PubChem CID 142498700) has the molecular formula C23H27ClN6O4 and a molecular weight of 486.96 g/mol. Its IUPAC name is 1-[2-chloro-4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]pentan-1-ol.
| Compound Name | 1-[2-chloro-4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]pentan-1-ol |
|---|---|
| PubChem CID | 142498700 |
| Molecular Formula | C23H27ClN6O4 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 1-[2-chloro-4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]pentan-1-ol |
| SMILES | CCCCC(O)c1ccc2c(Nc3cn(-c4cc(OC)c(OC)c(OC)c4)cn3)nc(Cl)nn12 |
| InChI | InChI=1S/C23H27ClN6O4/c1-5-6-7-17(31)15-8-9-16-22(27-23(24)28-30(15)16)26-20-12-29(13-25-20)14-10-18(32-2)21(34-4)19(11-14)33-3/h8-13,17,31H,5-7H2,1-4H3,(H,26,27,28) |
| InChIKey | QGTFKLLKVBHUJW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 107.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |