About 1-(cyclobutylmethyl)-3,4-dihydro-2H-pyridine
1-(cyclobutylmethyl)-3,4-dihydro-2H-pyridine (PubChem CID 14249872) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-3,4-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-(cyclobutylmethyl)-3,4-dihydro-2H-pyridine |
| PubChem CID | 14249872 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 1-(cyclobutylmethyl)-3,4-dihydro-2H-pyridine |
| SMILES | C1=CN(CC2CCC2)CCC1 |
| InChI | InChI=1S/C10H17N/c1-2-7-11(8-3-1)9-10-5-4-6-10/h2,7,10H,1,3-6,8-9H2 |
| InChIKey | UOEFDEBYQLLSMK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(cyclobutylmethyl)-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclobutylmethyl)-3,4-dihydro-2H-pyridine?
The IUPAC name of 1-(cyclobutylmethyl)-3,4-dihydro-2H-pyridine (CID 14249872) is 1-(cyclobutylmethyl)-3,4-dihydro-2H-pyridine.
What is the SMILES notation for 1-(cyclobutylmethyl)-3,4-dihydro-2H-pyridine?
The canonical SMILES for 1-(cyclobutylmethyl)-3,4-dihydro-2H-pyridine is C1=CN(CC2CCC2)CCC1.
What is the InChIKey of 1-(cyclobutylmethyl)-3,4-dihydro-2H-pyridine?
The InChIKey is UOEFDEBYQLLSMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-2-7-11(8-3-1)9-10-5-4-6-10/h2,7,10H,1,3-6,8-9H2.
What are the key properties of 1-(cyclobutylmethyl)-3,4-dihydro-2H-pyridine?
1-(cyclobutylmethyl)-3,4-dihydro-2H-pyridine has a molecular weight of 151.25 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclobutylmethyl)-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 14249872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).