About 3-bromopropyl (Z)-dec-3-enoate
3-bromopropyl (Z)-dec-3-enoate (PubChem CID 142498877) has the molecular formula C13H23BrO2
and a molecular weight of 291.23 g/mol. Its IUPAC name is 3-bromopropyl (Z)-dec-3-enoate.
Molecular Properties
| Compound Name | 3-bromopropyl (Z)-dec-3-enoate |
| PubChem CID | 142498877 |
| Molecular Formula | C13H23BrO2 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3-bromopropyl (Z)-dec-3-enoate |
| SMILES | CCCCCC/C=C\CC(=O)OCCCBr |
| InChI | InChI=1S/C13H23BrO2/c1-2-3-4-5-6-7-8-10-13(15)16-12-9-11-14/h7-8H,2-6,9-12H2,1H3/b8-7- |
| InChIKey | JZSPONSVLSBKQD-FPLPWBNLSA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-bromopropyl (Z)-dec-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromopropyl (Z)-dec-3-enoate?
The IUPAC name of 3-bromopropyl (Z)-dec-3-enoate (CID 142498877) is 3-bromopropyl (Z)-dec-3-enoate.
What is the SMILES notation for 3-bromopropyl (Z)-dec-3-enoate?
The canonical SMILES for 3-bromopropyl (Z)-dec-3-enoate is CCCCCC/C=C\CC(=O)OCCCBr.
What is the InChIKey of 3-bromopropyl (Z)-dec-3-enoate?
The InChIKey is JZSPONSVLSBKQD-FPLPWBNLSA-N. The full InChI is InChI=1S/C13H23BrO2/c1-2-3-4-5-6-7-8-10-13(15)16-12-9-11-14/h7-8H,2-6,9-12H2,1H3/b8-7-.
What are the key properties of 3-bromopropyl (Z)-dec-3-enoate?
3-bromopropyl (Z)-dec-3-enoate has a molecular weight of 291.23 g/mol, XLogP of 4.23, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromopropyl (Z)-dec-3-enoate is sourced from PubChem (CID 142498877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).