About 3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one;ethane
3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one;ethane (PubChem CID 142498981) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one;ethane.
Molecular Properties
| Compound Name | 3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one;ethane |
| PubChem CID | 142498981 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one;ethane |
| SMILES | C/N=C(\C)c1ccc[nH]c1=O.CC.CC |
| InChI | InChI=1S/C8H10N2O.2C2H6/c1-6(9-2)7-4-3-5-10-8(7)11;2*1-2/h3-5H,1-2H3,(H,10,11);2*1-2H3/b9-6+;; |
| InChIKey | GGXICFJRBXFVMO-SWSRPJROSA-N |
| XLogP | 2.87 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one;ethane?
The IUPAC name of 3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one;ethane (CID 142498981) is 3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one;ethane.
What is the SMILES notation for 3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one;ethane?
The canonical SMILES for 3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one;ethane is C/N=C(\C)c1ccc[nH]c1=O.CC.CC.
What is the InChIKey of 3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one;ethane?
The InChIKey is GGXICFJRBXFVMO-SWSRPJROSA-N. The full InChI is InChI=1S/C8H10N2O.2C2H6/c1-6(9-2)7-4-3-5-10-8(7)11;2*1-2/h3-5H,1-2H3,(H,10,11);2*1-2H3/b9-6+;;.
What are the key properties of 3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one;ethane?
3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one;ethane has a molecular weight of 210.32 g/mol, XLogP of 2.87, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one;ethane is sourced from PubChem (CID 142498981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).