C19H23N5O4S2 — CID 142499063
S-[(3S,7S)-7-cyano-8a-(1-hydroxyethylsulfanyl)-2,3,7-trimethyl-1,4-dioxo-6-pyrimidin-5-yl-6,8-dihydropyrrolo[1,2-a]pyrazin-3-yl] ethanethioate (PubChem CID 142499063) has the molecular formula C19H23N5O4S2 and a molecular weight of 449.56 g/mol. Its IUPAC name is S-[(3S,7S)-7-cyano-8a-(1-hydroxyethylsulfanyl)-2,3,7-trimethyl-1,4-dioxo-6-pyrimidin-5-yl-6,8-dihydropyrrolo[1,2-a]pyrazin-3-yl] ethanethioate.
| Compound Name | S-[(3S,7S)-7-cyano-8a-(1-hydroxyethylsulfanyl)-2,3,7-trimethyl-1,4-dioxo-6-pyrimidin-5-yl-6,8-dihydropyrrolo[1,2-a]pyrazin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 142499063 |
| Molecular Formula | C19H23N5O4S2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | S-[(3S,7S)-7-cyano-8a-(1-hydroxyethylsulfanyl)-2,3,7-trimethyl-1,4-dioxo-6-pyrimidin-5-yl-6,8-dihydropyrrolo[1,2-a]pyrazin-3-yl] ethanethioate |
| SMILES | CC(=O)S[C@@]1(C)C(=O)N2C(c3cncnc3)[C@@](C)(C#N)CC2(SC(C)O)C(=O)N1C |
| InChI | InChI=1S/C19H23N5O4S2/c1-11(25)29-18(4)15(27)24-14(13-6-21-10-22-7-13)17(3,9-20)8-19(24,30-12(2)26)16(28)23(18)5/h6-7,10,12,14,26H,8H2,1-5H3/t12?,14?,17-,18+,19?/m1/s1 |
| InChIKey | DZNFZOUMTMDLQV-JEFMWNAHSA-N |
| XLogP | 1.52 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|