C18H21FN2O4 — CID 142499095
methyl (3R,7S)-6-(4-fluorophenyl)-2,3,7-trimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carboxylate (PubChem CID 142499095) has the molecular formula C18H21FN2O4 and a molecular weight of 348.37 g/mol. Its IUPAC name is methyl (3R,7S)-6-(4-fluorophenyl)-2,3,7-trimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carboxylate.
| Compound Name | methyl (3R,7S)-6-(4-fluorophenyl)-2,3,7-trimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 142499095 |
| Molecular Formula | C18H21FN2O4 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | methyl (3R,7S)-6-(4-fluorophenyl)-2,3,7-trimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CC2C(=O)N(C)[C@H](C)C(=O)N2C1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H21FN2O4/c1-10-15(22)21-13(16(23)20(10)3)9-18(2,17(24)25-4)14(21)11-5-7-12(19)8-6-11/h5-8,10,13-14H,9H2,1-4H3/t10-,13?,14?,18+/m1/s1 |
| InChIKey | XUXKOXUUFFASBX-CDQGEJIPSA-N |
| XLogP | 1.51 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |