C15H11FN2O3 — CID 142499867
4-(4-cyclopropylimidazol-1-yl)-5-fluoro-1-benzofuran-2-carboxylic acid (PubChem CID 142499867) has the molecular formula C15H11FN2O3 and a molecular weight of 286.26 g/mol. Its IUPAC name is 4-(4-cyclopropylimidazol-1-yl)-5-fluoro-1-benzofuran-2-carboxylic acid.
| Compound Name | 4-(4-cyclopropylimidazol-1-yl)-5-fluoro-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 142499867 |
| Molecular Formula | C15H11FN2O3 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4-(4-cyclopropylimidazol-1-yl)-5-fluoro-1-benzofuran-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(-n3cnc(C4CC4)c3)c(F)ccc2o1 |
| InChI | InChI=1S/C15H11FN2O3/c16-10-3-4-12-9(5-13(21-12)15(19)20)14(10)18-6-11(17-7-18)8-1-2-8/h3-8H,1-2H2,(H,19,20) |
| InChIKey | OAYWEGFQNGCGSC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |