C19H27Br — CID 142500384
9-bromo-2,2,3,3,5,5,6,6-octamethyltricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene (PubChem CID 142500384) has the molecular formula C19H27Br and a molecular weight of 335.33 g/mol. Its IUPAC name is 9-bromo-2,2,3,3,5,5,6,6-octamethyltricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene.
| Compound Name | 9-bromo-2,2,3,3,5,5,6,6-octamethyltricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene |
|---|---|
| PubChem CID | 142500384 |
| Molecular Formula | C19H27Br |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 9-bromo-2,2,3,3,5,5,6,6-octamethyltricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene |
| SMILES | CC1(C)c2cc(Br)cc3c2C(C1(C)C)C(C)(C)C3(C)C |
| InChI | InChI=1S/C19H27Br/c1-16(2)12-9-11(20)10-13-14(12)15(18(16,5)6)19(7,8)17(13,3)4/h9-10,15H,1-8H3 |
| InChIKey | CCGLATZYBXIKAC-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |