C17H17NO4 — CID 142501019
methyl (1S,3S)-6,7-dihydroxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylate (PubChem CID 142501019) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is methyl (1S,3S)-6,7-dihydroxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylate.
| Compound Name | methyl (1S,3S)-6,7-dihydroxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 142501019 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | methyl (1S,3S)-6,7-dihydroxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2cc(O)c(O)cc2[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C17H17NO4/c1-22-17(21)13-7-11-8-14(19)15(20)9-12(11)16(18-13)10-5-3-2-4-6-10/h2-6,8-9,13,16,18-20H,7H2,1H3/t13-,16-/m0/s1 |
| InChIKey | ICNIPWZWRXXQSE-BBRMVZONSA-N |
| XLogP | 1.87 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|