C16H25N3O2 — CID 142501212
2-(hydroxymethyl)-N-(2-methylpropyl)-1H-benzimidazole-4-carboxamide;propane (PubChem CID 142501212) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-(hydroxymethyl)-N-(2-methylpropyl)-1H-benzimidazole-4-carboxamide;propane.
| Compound Name | 2-(hydroxymethyl)-N-(2-methylpropyl)-1H-benzimidazole-4-carboxamide;propane |
|---|---|
| PubChem CID | 142501212 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 2-(hydroxymethyl)-N-(2-methylpropyl)-1H-benzimidazole-4-carboxamide;propane |
| SMILES | CC(C)CNC(=O)c1cccc2[nH]c(CO)nc12.CCC |
| InChI | InChI=1S/C13H17N3O2.C3H8/c1-8(2)6-14-13(18)9-4-3-5-10-12(9)16-11(7-17)15-10;1-3-2/h3-5,8,17H,6-7H2,1-2H3,(H,14,18)(H,15,16);3H2,1-2H3 |
| InChIKey | GXPWOUKAQUFDHJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |