C21F8N4O — CID 142501697
2-(4,5,6,7,15,16,17,18-octafluoro-20-oxo-11,12-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,10,12,14(19),15,17-nonaen-9-ylidene)propanedinitrile (PubChem CID 142501697) has the molecular formula C21F8N4O and a molecular weight of 476.24 g/mol. Its IUPAC name is 2-(4,5,6,7,15,16,17,18-octafluoro-20-oxo-11,12-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,10,12,14(19),15,17-nonaen-9-ylidene)propanedinitrile.
| Compound Name | 2-(4,5,6,7,15,16,17,18-octafluoro-20-oxo-11,12-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,10,12,14(19),15,17-nonaen-9-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 142501697 |
| Molecular Formula | C21F8N4O |
| Molecular Weight | 476.24 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | 2-(4,5,6,7,15,16,17,18-octafluoro-20-oxo-11,12-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,10,12,14(19),15,17-nonaen-9-ylidene)propanedinitrile |
| SMILES | N#CC(C#N)=C1c2nnc3c(c2-c2c(F)c(F)c(F)c(F)c21)C(=O)c1c(F)c(F)c(F)c(F)c1-3 |
| InChI | InChI=1S/C21F8N4O/c22-11-5-4(3(1-30)2-31)19-7(6(5)12(23)16(27)15(11)26)10-20(33-32-19)8-9(21(10)34)14(25)18(29)17(28)13(8)24 |
| InChIKey | JWKYEEPUOVCTLF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 90.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.24 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|