C21H21F2N5O2S — CID 142502256
N-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]-1-[(3,5-difluorophenyl)methyl]-3-methyl-2-oxopyrido[2,3-b][1,4]thiazine-7-carboxamide (PubChem CID 142502256) has the molecular formula C21H21F2N5O2S and a molecular weight of 445.50 g/mol. Its IUPAC name is N-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]-1-[(3,5-difluorophenyl)methyl]-3-methyl-2-oxopyrido[2,3-b][1,4]thiazine-7-carboxamide.
| Compound Name | N-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]-1-[(3,5-difluorophenyl)methyl]-3-methyl-2-oxopyrido[2,3-b][1,4]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 142502256 |
| Molecular Formula | C21H21F2N5O2S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]-1-[(3,5-difluorophenyl)methyl]-3-methyl-2-oxopyrido[2,3-b][1,4]thiazine-7-carboxamide |
| SMILES | CC1Sc2ncc(C(=O)NC/C(N)=C/C=C\N)cc2N(Cc2cc(F)cc(F)c2)C1=O |
| InChI | InChI=1S/C21H21F2N5O2S/c1-12-21(30)28(11-13-5-15(22)8-16(23)6-13)18-7-14(9-27-20(18)31-12)19(29)26-10-17(25)3-2-4-24/h2-9,12H,10-11,24-25H2,1H3,(H,26,29)/b4-2-,17-3- |
| InChIKey | XBTIKPLVZBBBMP-XOXLSKNZSA-N |
| XLogP | 2.43 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|