C27H29ClN4 — CID 142502951
3-(5-amino-4-chloro-3-pyridinyl)-1-[(4E,6Z,8E)-3,8-dimethyldeca-4,6,8-trien-5-yl]-6-methylindole-5-carbonitrile (PubChem CID 142502951) has the molecular formula C27H29ClN4 and a molecular weight of 445.01 g/mol. Its IUPAC name is 3-(5-amino-4-chloro-3-pyridinyl)-1-[(4E,6Z,8E)-3,8-dimethyldeca-4,6,8-trien-5-yl]-6-methylindole-5-carbonitrile.
| Compound Name | 3-(5-amino-4-chloro-3-pyridinyl)-1-[(4E,6Z,8E)-3,8-dimethyldeca-4,6,8-trien-5-yl]-6-methylindole-5-carbonitrile |
|---|---|
| PubChem CID | 142502951 |
| Molecular Formula | C27H29ClN4 |
| Molecular Weight | 445.01 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 3-(5-amino-4-chloro-3-pyridinyl)-1-[(4E,6Z,8E)-3,8-dimethyldeca-4,6,8-trien-5-yl]-6-methylindole-5-carbonitrile |
| SMILES | C/C=C(C)/C=C\C(=C/C(C)CC)n1cc(-c2cncc(N)c2Cl)c2cc(C#N)c(C)cc21 |
| InChI | InChI=1S/C27H29ClN4/c1-6-17(3)8-9-21(10-18(4)7-2)32-16-24(23-14-31-15-25(30)27(23)28)22-12-20(13-29)19(5)11-26(22)32/h6,8-12,14-16,18H,7,30H2,1-5H3/b9-8-,17-6+,21-10+ |
| InChIKey | XJZZWPNLGODWQT-VIWQKANHSA-N |
| XLogP | 7.53 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.01 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|