About (5-ethylsulfonyl-1,3-thiazol-2-yl)methanamine;hydrochloride
(5-ethylsulfonyl-1,3-thiazol-2-yl)methanamine;hydrochloride (PubChem CID 142503440) has the molecular formula C6H11ClN2O2S2
and a molecular weight of 242.75 g/mol. Its IUPAC name is (5-ethylsulfonyl-1,3-thiazol-2-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (5-ethylsulfonyl-1,3-thiazol-2-yl)methanamine;hydrochloride |
| PubChem CID | 142503440 |
| Molecular Formula | C6H11ClN2O2S2 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | (5-ethylsulfonyl-1,3-thiazol-2-yl)methanamine;hydrochloride |
| SMILES | CCS(=O)(=O)c1cnc(CN)s1.Cl |
| InChI | InChI=1S/C6H10N2O2S2.ClH/c1-2-12(9,10)6-4-8-5(3-7)11-6;/h4H,2-3,7H2,1H3;1H |
| InChIKey | CNRXYAMUIBUOJA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-ethylsulfonyl-1,3-thiazol-2-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethylsulfonyl-1,3-thiazol-2-yl)methanamine;hydrochloride?
The IUPAC name of (5-ethylsulfonyl-1,3-thiazol-2-yl)methanamine;hydrochloride (CID 142503440) is (5-ethylsulfonyl-1,3-thiazol-2-yl)methanamine;hydrochloride.
What is the SMILES notation for (5-ethylsulfonyl-1,3-thiazol-2-yl)methanamine;hydrochloride?
The canonical SMILES for (5-ethylsulfonyl-1,3-thiazol-2-yl)methanamine;hydrochloride is CCS(=O)(=O)c1cnc(CN)s1.Cl.
What is the InChIKey of (5-ethylsulfonyl-1,3-thiazol-2-yl)methanamine;hydrochloride?
The InChIKey is CNRXYAMUIBUOJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2S2.ClH/c1-2-12(9,10)6-4-8-5(3-7)11-6;/h4H,2-3,7H2,1H3;1H.
What are the key properties of (5-ethylsulfonyl-1,3-thiazol-2-yl)methanamine;hydrochloride?
(5-ethylsulfonyl-1,3-thiazol-2-yl)methanamine;hydrochloride has a molecular weight of 242.75 g/mol, XLogP of 0.82, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethylsulfonyl-1,3-thiazol-2-yl)methanamine;hydrochloride is sourced from PubChem (CID 142503440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).