C19H23F3N2O2 — CID 142503583
ethyl 2-tert-butyl-5-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]imidazole-4-carboxylate (PubChem CID 142503583) has the molecular formula C19H23F3N2O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is ethyl 2-tert-butyl-5-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | ethyl 2-tert-butyl-5-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 142503583 |
| Molecular Formula | C19H23F3N2O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | ethyl 2-tert-butyl-5-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(C(C)(C)C)n(Cc2ccccc2C(F)(F)F)c1C |
| InChI | InChI=1S/C19H23F3N2O2/c1-6-26-16(25)15-12(2)24(17(23-15)18(3,4)5)11-13-9-7-8-10-14(13)19(20,21)22/h7-10H,6,11H2,1-5H3 |
| InChIKey | DZSSMHPRUSCWNQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |