C8H14O — CID 14250391
(4E)-6-methylhepta-4,6-dien-1-ol (PubChem CID 14250391) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (4E)-6-methylhepta-4,6-dien-1-ol.
| Compound Name | (4E)-6-methylhepta-4,6-dien-1-ol |
|---|---|
| PubChem CID | 14250391 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (4E)-6-methylhepta-4,6-dien-1-ol |
| SMILES | C=C(C)/C=C/CCCO |
| InChI | InChI=1S/C8H14O/c1-8(2)6-4-3-5-7-9/h4,6,9H,1,3,5,7H2,2H3/b6-4+ |
| InChIKey | VGYTUQJSBSMOPX-GQCTYLIASA-N |
| XLogP | 1.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|