C31H33F4N5O5 — CID 142504155
tert-butyl 5-[[(2R,4R)-4-fluoro-1-[1-[4-(2,2,2-trifluoroacetyl)phenyl]cyclohexanecarbonyl]pyrrolidine-2-carbonyl]amino]pyrazolo[4,5-b]pyridine-1-carboxylate (PubChem CID 142504155) has the molecular formula C31H33F4N5O5 and a molecular weight of 631.63 g/mol. Its IUPAC name is tert-butyl 5-[[(2R,4R)-4-fluoro-1-[1-[4-(2,2,2-trifluoroacetyl)phenyl]cyclohexanecarbonyl]pyrrolidine-2-carbonyl]amino]pyrazolo[4,5-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl 5-[[(2R,4R)-4-fluoro-1-[1-[4-(2,2,2-trifluoroacetyl)phenyl]cyclohexanecarbonyl]pyrrolidine-2-carbonyl]amino]pyrazolo[4,5-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 142504155 |
| Molecular Formula | C31H33F4N5O5 |
| Molecular Weight | 631.63 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | tert-butyl 5-[[(2R,4R)-4-fluoro-1-[1-[4-(2,2,2-trifluoroacetyl)phenyl]cyclohexanecarbonyl]pyrrolidine-2-carbonyl]amino]pyrazolo[4,5-b]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ncc2nc(NC(=O)[C@H]3C[C@@H](F)CN3C(=O)C3(c4ccc(C(=O)C(F)(F)F)cc4)CCCCC3)ccc21 |
| InChI | InChI=1S/C31H33F4N5O5/c1-29(2,3)45-28(44)40-22-11-12-24(37-21(22)16-36-40)38-26(42)23-15-20(32)17-39(23)27(43)30(13-5-4-6-14-30)19-9-7-18(8-10-19)25(41)31(33,34)35/h7-12,16,20,23H,4-6,13-15,17H2,1-3H3,(H,37,38,42)/t20-,23-/m1/s1 |
| InChIKey | WVCXENKIPBIKPI-NFBKMPQASA-N |
| XLogP | 5.74 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.63 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |