C19H28FNO5Si — CID 142504278
(2R,3S,4S)-4-fluoro-1-phenylmethoxycarbonyl-3-triethylsilyloxypyrrolidine-2-carboxylic acid (PubChem CID 142504278) has the molecular formula C19H28FNO5Si and a molecular weight of 397.52 g/mol. Its IUPAC name is (2R,3S,4S)-4-fluoro-1-phenylmethoxycarbonyl-3-triethylsilyloxypyrrolidine-2-carboxylic acid.
| Compound Name | (2R,3S,4S)-4-fluoro-1-phenylmethoxycarbonyl-3-triethylsilyloxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 142504278 |
| Molecular Formula | C19H28FNO5Si |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (2R,3S,4S)-4-fluoro-1-phenylmethoxycarbonyl-3-triethylsilyloxypyrrolidine-2-carboxylic acid |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H](F)CN(C(=O)OCc2ccccc2)[C@H]1C(=O)O |
| InChI | InChI=1S/C19H28FNO5Si/c1-4-27(5-2,6-3)26-17-15(20)12-21(16(17)18(22)23)19(24)25-13-14-10-8-7-9-11-14/h7-11,15-17H,4-6,12-13H2,1-3H3,(H,22,23)/t15-,16+,17+/m0/s1 |
| InChIKey | PQUJGKAXSBHSMJ-GVDBMIGSSA-N |
| XLogP | 3.82 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|