About [5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl 3-hydroxy-4-oxobutanoate;methanol
[5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl 3-hydroxy-4-oxobutanoate;methanol (PubChem CID 142505319) has the molecular formula C16H24N2O7
and a molecular weight of 356.38 g/mol. Its IUPAC name is [5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl 3-hydroxy-4-oxobutanoate;methanol.
Molecular Properties
| Compound Name | [5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl 3-hydroxy-4-oxobutanoate;methanol |
| PubChem CID | 142505319 |
| Molecular Formula | C16H24N2O7 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl 3-hydroxy-4-oxobutanoate;methanol |
| SMILES | CO.NC(=O)C1=CN(C2CCC(COC(=O)CC(O)C=O)O2)C=CC1 |
| InChI | InChI=1S/C15H20N2O6.CH4O/c16-15(21)10-2-1-5-17(7-10)13-4-3-12(23-13)9-22-14(20)6-11(19)8-18;1-2/h1,5,7-8,11-13,19H,2-4,6,9H2,(H2,16,21);2H,1H3 |
| InChIKey | UVGWNJQPUFAMLO-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl 3-hydroxy-4-oxobutanoate;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl 3-hydroxy-4-oxobutanoate;methanol?
The IUPAC name of [5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl 3-hydroxy-4-oxobutanoate;methanol (CID 142505319) is [5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl 3-hydroxy-4-oxobutanoate;methanol.
What is the SMILES notation for [5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl 3-hydroxy-4-oxobutanoate;methanol?
The canonical SMILES for [5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl 3-hydroxy-4-oxobutanoate;methanol is CO.NC(=O)C1=CN(C2CCC(COC(=O)CC(O)C=O)O2)C=CC1.
What is the InChIKey of [5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl 3-hydroxy-4-oxobutanoate;methanol?
The InChIKey is UVGWNJQPUFAMLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O6.CH4O/c16-15(21)10-2-1-5-17(7-10)13-4-3-12(23-13)9-22-14(20)6-11(19)8-18;1-2/h1,5,7-8,11-13,19H,2-4,6,9H2,(H2,16,21);2H,1H3.
What are the key properties of [5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl 3-hydroxy-4-oxobutanoate;methanol?
[5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl 3-hydroxy-4-oxobutanoate;methanol has a molecular weight of 356.38 g/mol, XLogP of -0.82, 7 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl 3-hydroxy-4-oxobutanoate;methanol is sourced from PubChem (CID 142505319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).