C21H19Cl2N3OS — CID 142505369
2-(3,4-dichlorophenyl)-N-[[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine (PubChem CID 142505369) has the molecular formula C21H19Cl2N3OS and a molecular weight of 432.38 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 142505369 |
| Molecular Formula | C21H19Cl2N3OS |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine |
| SMILES | COc1ccc(-c2nc3sccn3c2CNCCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H19Cl2N3OS/c1-27-16-5-3-15(4-6-16)20-19(26-10-11-28-21(26)25-20)13-24-9-8-14-2-7-17(22)18(23)12-14/h2-7,10-12,24H,8-9,13H2,1H3 |
| InChIKey | AMDXEVFRALNSNL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|