C23H12F5N3O2 — CID 142505390
(E)-1-(6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazol-5-yl)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]methanimine (PubChem CID 142505390) has the molecular formula C23H12F5N3O2 and a molecular weight of 457.36 g/mol. Its IUPAC name is (E)-1-(6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazol-5-yl)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]methanimine.
| Compound Name | (E)-1-(6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazol-5-yl)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]methanimine |
|---|---|
| PubChem CID | 142505390 |
| Molecular Formula | C23H12F5N3O2 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | (E)-1-(6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazol-5-yl)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]methanimine |
| SMILES | Fc1c(F)c(F)c(CO/N=C/c2c(-c3ccc4ccccc4c3)nc3occn23)c(F)c1F |
| InChI | InChI=1S/C23H12F5N3O2/c24-17-15(18(25)20(27)21(28)19(17)26)11-33-29-10-16-22(30-23-31(16)7-8-32-23)14-6-5-12-3-1-2-4-13(12)9-14/h1-10H,11H2/b29-10+ |
| InChIKey | JNYDAGBXXMQUBO-VYVUJPJFSA-N |
| XLogP | 5.99 |
| TPSA | 52.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|