C25H19N3O2 — CID 142505396
(E)-N-(2,3-dihydro-1H-inden-2-yloxy)-1-(6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazol-5-yl)methanimine (PubChem CID 142505396) has the molecular formula C25H19N3O2 and a molecular weight of 393.45 g/mol. Its IUPAC name is (E)-N-(2,3-dihydro-1H-inden-2-yloxy)-1-(6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazol-5-yl)methanimine.
| Compound Name | (E)-N-(2,3-dihydro-1H-inden-2-yloxy)-1-(6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazol-5-yl)methanimine |
|---|---|
| PubChem CID | 142505396 |
| Molecular Formula | C25H19N3O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (E)-N-(2,3-dihydro-1H-inden-2-yloxy)-1-(6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazol-5-yl)methanimine |
| SMILES | C(=N/OC1Cc2ccccc2C1)\c1c(-c2ccc3ccccc3c2)nc2occn12 |
| InChI | InChI=1S/C25H19N3O2/c1-2-6-18-13-21(10-9-17(18)5-1)24-23(28-11-12-29-25(28)27-24)16-26-30-22-14-19-7-3-4-8-20(19)15-22/h1-13,16,22H,14-15H2/b26-16+ |
| InChIKey | CRQDSRXCPJYGDB-WGOQTCKBSA-N |
| XLogP | 5.27 |
| TPSA | 52.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|