C20H16Cl2FN3S — CID 142505403
2-(3,4-dichlorophenyl)-N-[[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine (PubChem CID 142505403) has the molecular formula C20H16Cl2FN3S and a molecular weight of 420.34 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 142505403 |
| Molecular Formula | C20H16Cl2FN3S |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine |
| SMILES | Fc1ccc(-c2nc3sccn3c2CNCCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H16Cl2FN3S/c21-16-6-1-13(11-17(16)22)7-8-24-12-18-19(14-2-4-15(23)5-3-14)25-20-26(18)9-10-27-20/h1-6,9-11,24H,7-8,12H2 |
| InChIKey | ACYYAKYCHSRGFX-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|