C20H16Cl3N3S — CID 142505420
N-[[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]-2-(3,4-dichlorophenyl)ethanamine (PubChem CID 142505420) has the molecular formula C20H16Cl3N3S and a molecular weight of 436.80 g/mol. Its IUPAC name is N-[[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]-2-(3,4-dichlorophenyl)ethanamine.
| Compound Name | N-[[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]-2-(3,4-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 142505420 |
| Molecular Formula | C20H16Cl3N3S |
| Molecular Weight | 436.80 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | N-[[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]-2-(3,4-dichlorophenyl)ethanamine |
| SMILES | Clc1ccc(-c2nc3sccn3c2CNCCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H16Cl3N3S/c21-15-4-2-14(3-5-15)19-18(26-9-10-27-20(26)25-19)12-24-8-7-13-1-6-16(22)17(23)11-13/h1-6,9-11,24H,7-8,12H2 |
| InChIKey | PEMODJCBCAKYMD-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.80 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|