C20H14Cl3N3S — CID 142505467
1-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[2-(3,4-dichlorophenyl)ethyl]methanimine (PubChem CID 142505467) has the molecular formula C20H14Cl3N3S and a molecular weight of 434.78 g/mol. Its IUPAC name is 1-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[2-(3,4-dichlorophenyl)ethyl]methanimine.
| Compound Name | 1-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[2-(3,4-dichlorophenyl)ethyl]methanimine |
|---|---|
| PubChem CID | 142505467 |
| Molecular Formula | C20H14Cl3N3S |
| Molecular Weight | 434.78 g/mol |
| Exact Mass | 433.00 |
| IUPAC Name | 1-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[2-(3,4-dichlorophenyl)ethyl]methanimine |
| SMILES | Clc1ccc(-c2nc3sccn3c2/C=N/CCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H14Cl3N3S/c21-15-4-2-14(3-5-15)19-18(26-9-10-27-20(26)25-19)12-24-8-7-13-1-6-16(22)17(23)11-13/h1-6,9-12H,7-8H2/b24-12+ |
| InChIKey | SKAFAZCCABIHMK-WYMPLXKRSA-N |
| XLogP | 6.68 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.78 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|