C20H17Cl2N3S — CID 142505477
2-(3,4-dichlorophenyl)-N-[(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine (PubChem CID 142505477) has the molecular formula C20H17Cl2N3S and a molecular weight of 402.35 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 142505477 |
| Molecular Formula | C20H17Cl2N3S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine |
| SMILES | Clc1ccc(CCNCc2c(-c3ccccc3)nc3sccn23)cc1Cl |
| InChI | InChI=1S/C20H17Cl2N3S/c21-16-7-6-14(12-17(16)22)8-9-23-13-18-19(15-4-2-1-3-5-15)24-20-25(18)10-11-26-20/h1-7,10-12,23H,8-9,13H2 |
| InChIKey | ZPWMKEUEFAPJMX-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|