C20H15Cl2N3O2S — CID 142505480
(E)-N-[(3,4-dichlorophenyl)methoxy]-1-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methanimine (PubChem CID 142505480) has the molecular formula C20H15Cl2N3O2S and a molecular weight of 432.33 g/mol. Its IUPAC name is (E)-N-[(3,4-dichlorophenyl)methoxy]-1-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methanimine.
| Compound Name | (E)-N-[(3,4-dichlorophenyl)methoxy]-1-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methanimine |
|---|---|
| PubChem CID | 142505480 |
| Molecular Formula | C20H15Cl2N3O2S |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | (E)-N-[(3,4-dichlorophenyl)methoxy]-1-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methanimine |
| SMILES | COc1ccc(-c2nc3sccn3c2/C=N/OCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H15Cl2N3O2S/c1-26-15-5-3-14(4-6-15)19-18(25-8-9-28-20(25)24-19)11-23-27-12-13-2-7-16(21)17(22)10-13/h2-11H,12H2,1H3/b23-11+ |
| InChIKey | VFSYNQQGMHIFPI-FOKLQQMPSA-N |
| XLogP | 5.93 |
| TPSA | 48.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|