C7H8O2S5 — CID 14250612
(5R,6R)-5,6-bis(hydroxymethyl)-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiine-2-thione (PubChem CID 14250612) has the molecular formula C7H8O2S5 and a molecular weight of 284.47 g/mol. Its IUPAC name is (5R,6R)-5,6-bis(hydroxymethyl)-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiine-2-thione.
| Compound Name | (5R,6R)-5,6-bis(hydroxymethyl)-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiine-2-thione |
|---|---|
| PubChem CID | 14250612 |
| Molecular Formula | C7H8O2S5 |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 283.91 |
| IUPAC Name | (5R,6R)-5,6-bis(hydroxymethyl)-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiine-2-thione |
| SMILES | OC[C@H]1Sc2sc(=S)sc2S[C@@H]1CO |
| InChI | InChI=1S/C7H8O2S5/c8-1-3-4(2-9)12-6-5(11-3)13-7(10)14-6/h3-4,8-9H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | KLAJPKOFFXKFIA-QWWZWVQMSA-N |
| XLogP | 2.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|