C28H30N8O3 — CID 142506210
N-hydroxy-6-[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]hexanamide (PubChem CID 142506210) has the molecular formula C28H30N8O3 and a molecular weight of 526.60 g/mol. Its IUPAC name is N-hydroxy-6-[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]hexanamide.
| Compound Name | N-hydroxy-6-[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]hexanamide |
|---|---|
| PubChem CID | 142506210 |
| Molecular Formula | C28H30N8O3 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | N-hydroxy-6-[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]hexanamide |
| SMILES | CC[C@H](Nc1ncnc2nc[nH]c12)c1nc2cccc(CCCCCC(=O)NO)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C28H30N8O3/c1-2-20(33-26-24-25(30-16-29-24)31-17-32-26)27-34-21-14-9-11-18(10-5-3-8-15-22(37)35-39)23(21)28(38)36(27)19-12-6-4-7-13-19/h4,6-7,9,11-14,16-17,20,39H,2-3,5,8,10,15H2,1H3,(H,35,37)(H2,29,30,31,32,33)/t20-/m0/s1 |
| InChIKey | HQLYDYYQRFGZDZ-FQEVSTJZSA-N |
| XLogP | 4.22 |
| TPSA | 150.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|