C31H27N9O4 — CID 142506220
4-N-hydroxy-1-N-[[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]methyl]benzene-1,4-dicarboxamide (PubChem CID 142506220) has the molecular formula C31H27N9O4 and a molecular weight of 589.62 g/mol. Its IUPAC name is 4-N-hydroxy-1-N-[[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]methyl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-hydroxy-1-N-[[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]methyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 142506220 |
| Molecular Formula | C31H27N9O4 |
| Molecular Weight | 589.62 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | 4-N-hydroxy-1-N-[[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]methyl]benzene-1,4-dicarboxamide |
| SMILES | CC[C@H](Nc1ncnc2nc[nH]c12)c1nc2cccc(CNC(=O)c3ccc(C(=O)NO)cc3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C31H27N9O4/c1-2-22(37-27-25-26(34-16-33-25)35-17-36-27)28-38-23-10-6-7-20(24(23)31(43)40(28)21-8-4-3-5-9-21)15-32-29(41)18-11-13-19(14-12-18)30(42)39-44/h3-14,16-17,22,44H,2,15H2,1H3,(H,32,41)(H,39,42)(H2,33,34,35,36,37)/t22-/m0/s1 |
| InChIKey | SAXRXUSVNKFNJC-QFIPXVFZSA-N |
| XLogP | 3.66 |
| TPSA | 179.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.62 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|