C28H25N11O3 — CID 142506225
N-hydroxy-2-[[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]methylamino]pyrimidine-5-carboxamide (PubChem CID 142506225) has the molecular formula C28H25N11O3 and a molecular weight of 563.58 g/mol. Its IUPAC name is N-hydroxy-2-[[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]methylamino]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]methylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 142506225 |
| Molecular Formula | C28H25N11O3 |
| Molecular Weight | 563.58 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | N-hydroxy-2-[[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]methylamino]pyrimidine-5-carboxamide |
| SMILES | CC[C@H](Nc1ncnc2nc[nH]c12)c1nc2cccc(CNc3ncc(C(=O)NO)cn3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C28H25N11O3/c1-2-19(36-24-22-23(33-14-32-22)34-15-35-24)25-37-20-10-6-7-16(11-29-28-30-12-17(13-31-28)26(40)38-42)21(20)27(41)39(25)18-8-4-3-5-9-18/h3-10,12-15,19,42H,2,11H2,1H3,(H,38,40)(H,29,30,31)(H2,32,33,34,35,36)/t19-/m0/s1 |
| InChIKey | WJOMMYWEPXHYNA-IBGZPJMESA-N |
| XLogP | 3.14 |
| TPSA | 188.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|