About (3Z)-3-ethenyl-N-propylhexa-3,5-dienamide
(3Z)-3-ethenyl-N-propylhexa-3,5-dienamide (PubChem CID 142506323) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is (3Z)-3-ethenyl-N-propylhexa-3,5-dienamide.
Molecular Properties
| Compound Name | (3Z)-3-ethenyl-N-propylhexa-3,5-dienamide |
| PubChem CID | 142506323 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (3Z)-3-ethenyl-N-propylhexa-3,5-dienamide |
| SMILES | C=C/C=C(\C=C)CC(=O)NCCC |
| InChI | InChI=1S/C11H17NO/c1-4-7-10(6-3)9-11(13)12-8-5-2/h4,6-7H,1,3,5,8-9H2,2H3,(H,12,13)/b10-7+ |
| InChIKey | RRHHHPJAGFXJDW-JXMROGBWSA-N |
| XLogP | 2.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-ethenyl-N-propylhexa-3,5-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-ethenyl-N-propylhexa-3,5-dienamide?
The IUPAC name of (3Z)-3-ethenyl-N-propylhexa-3,5-dienamide (CID 142506323) is (3Z)-3-ethenyl-N-propylhexa-3,5-dienamide.
What is the SMILES notation for (3Z)-3-ethenyl-N-propylhexa-3,5-dienamide?
The canonical SMILES for (3Z)-3-ethenyl-N-propylhexa-3,5-dienamide is C=C/C=C(\C=C)CC(=O)NCCC.
What is the InChIKey of (3Z)-3-ethenyl-N-propylhexa-3,5-dienamide?
The InChIKey is RRHHHPJAGFXJDW-JXMROGBWSA-N. The full InChI is InChI=1S/C11H17NO/c1-4-7-10(6-3)9-11(13)12-8-5-2/h4,6-7H,1,3,5,8-9H2,2H3,(H,12,13)/b10-7+.
What are the key properties of (3Z)-3-ethenyl-N-propylhexa-3,5-dienamide?
(3Z)-3-ethenyl-N-propylhexa-3,5-dienamide has a molecular weight of 179.26 g/mol, XLogP of 2.20, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-ethenyl-N-propylhexa-3,5-dienamide is sourced from PubChem (CID 142506323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).