C24H22FN3O2S — CID 142506717
7-[3-fluoro-4-(methoxymethyl)phenyl]-2-pyridin-2-yl-3H-thieno[3,2-d]pyrimidin-4-one;(3Z)-penta-1,3-diene (PubChem CID 142506717) has the molecular formula C24H22FN3O2S and a molecular weight of 435.52 g/mol. Its IUPAC name is 7-[3-fluoro-4-(methoxymethyl)phenyl]-2-pyridin-2-yl-3H-thieno[3,2-d]pyrimidin-4-one;(3Z)-penta-1,3-diene.
| Compound Name | 7-[3-fluoro-4-(methoxymethyl)phenyl]-2-pyridin-2-yl-3H-thieno[3,2-d]pyrimidin-4-one;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 142506717 |
| Molecular Formula | C24H22FN3O2S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 7-[3-fluoro-4-(methoxymethyl)phenyl]-2-pyridin-2-yl-3H-thieno[3,2-d]pyrimidin-4-one;(3Z)-penta-1,3-diene |
| SMILES | C=C/C=C\C.COCc1ccc(-c2csc3c(=O)[nH]c(-c4ccccn4)nc23)cc1F |
| InChI | InChI=1S/C19H14FN3O2S.C5H8/c1-25-9-12-6-5-11(8-14(12)20)13-10-26-17-16(13)22-18(23-19(17)24)15-4-2-3-7-21-15;1-3-5-4-2/h2-8,10H,9H2,1H3,(H,22,23,24);3-5H,1H2,2H3/b;5-4- |
| InChIKey | CNOWSDPLFGRSJA-GUHKXDMSSA-N |
| XLogP | 5.75 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|