C14H18F3N — CID 142507692
1-methyl-4-(2,3,4-trifluoro-5,6-dimethylphenyl)piperidine (PubChem CID 142507692) has the molecular formula C14H18F3N and a molecular weight of 257.30 g/mol. Its IUPAC name is 1-methyl-4-(2,3,4-trifluoro-5,6-dimethylphenyl)piperidine.
| Compound Name | 1-methyl-4-(2,3,4-trifluoro-5,6-dimethylphenyl)piperidine |
|---|---|
| PubChem CID | 142507692 |
| Molecular Formula | C14H18F3N |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1-methyl-4-(2,3,4-trifluoro-5,6-dimethylphenyl)piperidine |
| SMILES | Cc1c(C)c(C2CCN(C)CC2)c(F)c(F)c1F |
| InChI | InChI=1S/C14H18F3N/c1-8-9(2)12(15)14(17)13(16)11(8)10-4-6-18(3)7-5-10/h10H,4-7H2,1-3H3 |
| InChIKey | NOUNPPGZCKCMPF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|