C44H27F3N4 — CID 142508152
2-[3-(4,6-diphenylpyrimidin-2-yl)-2,4,6-trifluoro-5-phenylphenyl]-4,6-diphenylpyrimidine (PubChem CID 142508152) has the molecular formula C44H27F3N4 and a molecular weight of 668.72 g/mol. Its IUPAC name is 2-[3-(4,6-diphenylpyrimidin-2-yl)-2,4,6-trifluoro-5-phenylphenyl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[3-(4,6-diphenylpyrimidin-2-yl)-2,4,6-trifluoro-5-phenylphenyl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 142508152 |
| Molecular Formula | C44H27F3N4 |
| Molecular Weight | 668.72 g/mol |
| Exact Mass | 668.22 |
| IUPAC Name | 2-[3-(4,6-diphenylpyrimidin-2-yl)-2,4,6-trifluoro-5-phenylphenyl]-4,6-diphenylpyrimidine |
| SMILES | Fc1c(-c2ccccc2)c(F)c(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)c(F)c1-c1nc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C44H27F3N4/c45-40-37(32-24-14-5-15-25-32)41(46)39(44-50-35(30-20-10-3-11-21-30)27-36(51-44)31-22-12-4-13-23-31)42(47)38(40)43-48-33(28-16-6-1-7-17-28)26-34(49-43)29-18-8-2-9-19-29/h1-27H |
| InChIKey | ZEIHWRXHRNGZLU-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.72 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |