C21H11F4N3 — CID 142508383
4,6-diphenyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)pyrimidine (PubChem CID 142508383) has the molecular formula C21H11F4N3 and a molecular weight of 381.33 g/mol. Its IUPAC name is 4,6-diphenyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)pyrimidine.
| Compound Name | 4,6-diphenyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)pyrimidine |
|---|---|
| PubChem CID | 142508383 |
| Molecular Formula | C21H11F4N3 |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 4,6-diphenyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)pyrimidine |
| SMILES | Fc1nc(F)c(F)c(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)c1F |
| InChI | InChI=1S/C21H11F4N3/c22-17-16(18(23)20(25)28-19(17)24)21-26-14(12-7-3-1-4-8-12)11-15(27-21)13-9-5-2-6-10-13/h1-11H |
| InChIKey | FVDBZCMGKLGWOR-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|