About 2-trimethylsilylethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate
2-trimethylsilylethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate (PubChem CID 142508516) has the molecular formula C13H26O3Si
and a molecular weight of 258.43 g/mol. Its IUPAC name is 2-trimethylsilylethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate |
| PubChem CID | 142508516 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-trimethylsilylethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate |
| SMILES | CC1(C(=O)OCC[Si](C)(C)C)CCC(O)CC1 |
| InChI | InChI=1S/C13H26O3Si/c1-13(7-5-11(14)6-8-13)12(15)16-9-10-17(2,3)4/h11,14H,5-10H2,1-4H3 |
| InChIKey | FPFWSBUQFKSIBH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate?
The IUPAC name of 2-trimethylsilylethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate (CID 142508516) is 2-trimethylsilylethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate.
What is the SMILES notation for 2-trimethylsilylethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate?
The canonical SMILES for 2-trimethylsilylethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate is CC1(C(=O)OCC[Si](C)(C)C)CCC(O)CC1.
What is the InChIKey of 2-trimethylsilylethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate?
The InChIKey is FPFWSBUQFKSIBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O3Si/c1-13(7-5-11(14)6-8-13)12(15)16-9-10-17(2,3)4/h11,14H,5-10H2,1-4H3.
What are the key properties of 2-trimethylsilylethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate?
2-trimethylsilylethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate has a molecular weight of 258.43 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate is sourced from PubChem (CID 142508516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).