C26H33N5O — CID 142508776
ethene;N-methyl-3-phenyl-3-[3-(2-piperazin-1-ylpyrimidin-4-yl)phenoxy]propan-1-amine (PubChem CID 142508776) has the molecular formula C26H33N5O and a molecular weight of 431.58 g/mol. Its IUPAC name is ethene;N-methyl-3-phenyl-3-[3-(2-piperazin-1-ylpyrimidin-4-yl)phenoxy]propan-1-amine.
| Compound Name | ethene;N-methyl-3-phenyl-3-[3-(2-piperazin-1-ylpyrimidin-4-yl)phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 142508776 |
| Molecular Formula | C26H33N5O |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | ethene;N-methyl-3-phenyl-3-[3-(2-piperazin-1-ylpyrimidin-4-yl)phenoxy]propan-1-amine |
| SMILES | C=C.CNCCC(Oc1cccc(-c2ccnc(N3CCNCC3)n2)c1)c1ccccc1 |
| InChI | InChI=1S/C24H29N5O.C2H4/c1-25-12-11-23(19-6-3-2-4-7-19)30-21-9-5-8-20(18-21)22-10-13-27-24(28-22)29-16-14-26-15-17-29;1-2/h2-10,13,18,23,25-26H,11-12,14-17H2,1H3;1-2H2 |
| InChIKey | CIMMULQDIWJHDZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|