C21H25N3O2S — CID 142510327
2-(5H-imidazo[5,1-a]isoindol-5-yl)-7-(oxetan-3-ylsulfanyl)-7-azaspiro[3.5]nonan-3-ol (PubChem CID 142510327) has the molecular formula C21H25N3O2S and a molecular weight of 383.52 g/mol. Its IUPAC name is 2-(5H-imidazo[5,1-a]isoindol-5-yl)-7-(oxetan-3-ylsulfanyl)-7-azaspiro[3.5]nonan-3-ol.
| Compound Name | 2-(5H-imidazo[5,1-a]isoindol-5-yl)-7-(oxetan-3-ylsulfanyl)-7-azaspiro[3.5]nonan-3-ol |
|---|---|
| PubChem CID | 142510327 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-(5H-imidazo[5,1-a]isoindol-5-yl)-7-(oxetan-3-ylsulfanyl)-7-azaspiro[3.5]nonan-3-ol |
| SMILES | OC1C(C2c3ccccc3-c3cncn32)CC12CCN(SC1COC1)CC2 |
| InChI | InChI=1S/C21H25N3O2S/c25-20-17(9-21(20)5-7-23(8-6-21)27-14-11-26-12-14)19-16-4-2-1-3-15(16)18-10-22-13-24(18)19/h1-4,10,13-14,17,19-20,25H,5-9,11-12H2 |
| InChIKey | MHTGVZUFINGZNP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|