C30H55NO2 — CID 142510908
4-[3-(2,3-dimethylcyclohexa-2,4-dien-1-yl)propyl]morpholine;ethane;[(Z)-hex-4-en-2-yl]oxymethylcyclohexane (PubChem CID 142510908) has the molecular formula C30H55NO2 and a molecular weight of 461.78 g/mol. Its IUPAC name is 4-[3-(2,3-dimethylcyclohexa-2,4-dien-1-yl)propyl]morpholine;ethane;[(Z)-hex-4-en-2-yl]oxymethylcyclohexane.
| Compound Name | 4-[3-(2,3-dimethylcyclohexa-2,4-dien-1-yl)propyl]morpholine;ethane;[(Z)-hex-4-en-2-yl]oxymethylcyclohexane |
|---|---|
| PubChem CID | 142510908 |
| Molecular Formula | C30H55NO2 |
| Molecular Weight | 461.78 g/mol |
| Exact Mass | 461.42 |
| IUPAC Name | 4-[3-(2,3-dimethylcyclohexa-2,4-dien-1-yl)propyl]morpholine;ethane;[(Z)-hex-4-en-2-yl]oxymethylcyclohexane |
| SMILES | C/C=C\CC(C)OCC1CCCCC1.CC.CC1=C(C)C(CCCN2CCOCC2)CC=C1 |
| InChI | InChI=1S/C15H25NO.C13H24O.C2H6/c1-13-5-3-6-15(14(13)2)7-4-8-16-9-11-17-12-10-16;1-3-4-8-12(2)14-11-13-9-6-5-7-10-13;1-2/h3,5,15H,4,6-12H2,1-2H3;3-4,12-13H,5-11H2,1-2H3;1-2H3/b;4-3-; |
| InChIKey | QWCDCEVBVHKCMS-LWFKIUJUSA-N |
| XLogP | 7.98 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.78 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|