C27H37N5 — CID 142510943
(E)-1-(4-cyclobutylidene-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3,5-trimethyl-4-methylidenehept-2-en-1-imine (PubChem CID 142510943) has the molecular formula C27H37N5 and a molecular weight of 431.63 g/mol. Its IUPAC name is (E)-1-(4-cyclobutylidene-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3,5-trimethyl-4-methylidenehept-2-en-1-imine.
| Compound Name | (E)-1-(4-cyclobutylidene-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3,5-trimethyl-4-methylidenehept-2-en-1-imine |
|---|---|
| PubChem CID | 142510943 |
| Molecular Formula | C27H37N5 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | (E)-1-(4-cyclobutylidene-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3,5-trimethyl-4-methylidenehept-2-en-1-imine |
| SMILES | C=C(/C(C)=C/C(=N\C)C1=CC(=C2CCC2)N2C=C(N3CCNCC3)C=CC2=N1)C(C)CC |
| InChI | InChI=1S/C27H37N5/c1-6-19(2)21(4)20(3)16-24(28-5)25-17-26(22-8-7-9-22)32-18-23(10-11-27(32)30-25)31-14-12-29-13-15-31/h10-11,16-19,29H,4,6-9,12-15H2,1-3,5H3/b20-16+,28-24+ |
| InChIKey | XWUOYLYENASPKE-XAMUNATISA-N |
| XLogP | 4.96 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|