C39H59N5 — CID 142510965
(E)-1-[4-cyclobutylidene-7-(4-cyclopropyl-3-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene (PubChem CID 142510965) has the molecular formula C39H59N5 and a molecular weight of 597.94 g/mol. Its IUPAC name is (E)-1-[4-cyclobutylidene-7-(4-cyclopropyl-3-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene.
| Compound Name | (E)-1-[4-cyclobutylidene-7-(4-cyclopropyl-3-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene |
|---|---|
| PubChem CID | 142510965 |
| Molecular Formula | C39H59N5 |
| Molecular Weight | 597.94 g/mol |
| Exact Mass | 597.48 |
| IUPAC Name | (E)-1-[4-cyclobutylidene-7-(4-cyclopropyl-3-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene |
| SMILES | C=C(CC)/C(C)=C/C(=N\C)C1=CC(=C2CCC2)N2C=C(N3CCN(C4CC4)C(C)C3)C=CC2=N1.CCC/C=C(/C)C(C)CC |
| InChI | InChI=1S/C29H39N5.C10H20/c1-6-20(2)21(3)16-26(30-5)27-17-28(23-8-7-9-23)34-19-25(12-13-29(34)31-27)32-14-15-33(22(4)18-32)24-10-11-24;1-5-7-8-10(4)9(3)6-2/h12-13,16-17,19,22,24H,2,6-11,14-15,18H2,1,3-5H3;8-9H,5-7H2,1-4H3/b21-16+,30-26+;10-8- |
| InChIKey | PEASDFPAXIYLEE-JFZWQLARSA-N |
| XLogP | 9.36 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.94 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|