C22H28N4O — CID 142510988
2-[(2E,4Z)-6-(dimethylamino)hepta-2,4,6-trien-3-yl]-7-piperidin-4-ylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 142510988) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-[(2E,4Z)-6-(dimethylamino)hepta-2,4,6-trien-3-yl]-7-piperidin-4-ylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[(2E,4Z)-6-(dimethylamino)hepta-2,4,6-trien-3-yl]-7-piperidin-4-ylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 142510988 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 2-[(2E,4Z)-6-(dimethylamino)hepta-2,4,6-trien-3-yl]-7-piperidin-4-ylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | C=C(/C=C\C(=C/C)c1cc(=O)n2cc(C3CCNCC3)ccc2n1)N(C)C |
| InChI | InChI=1S/C22H28N4O/c1-5-17(7-6-16(2)25(3)4)20-14-22(27)26-15-19(8-9-21(26)24-20)18-10-12-23-13-11-18/h5-9,14-15,18,23H,2,10-13H2,1,3-4H3/b7-6-,17-5+ |
| InChIKey | KNGOWTGOHGLXHA-MPCKZZPMSA-N |
| XLogP | 3.20 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|