C33H50N4O — CID 142511021
2-[(2E,7Z)-8,9-dimethylundeca-2,7-dien-2-yl]-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-4-one;(3Z)-3-methylhepta-1,3-diene (PubChem CID 142511021) has the molecular formula C33H50N4O and a molecular weight of 518.79 g/mol. Its IUPAC name is 2-[(2E,7Z)-8,9-dimethylundeca-2,7-dien-2-yl]-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-4-one;(3Z)-3-methylhepta-1,3-diene.
| Compound Name | 2-[(2E,7Z)-8,9-dimethylundeca-2,7-dien-2-yl]-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-4-one;(3Z)-3-methylhepta-1,3-diene |
|---|---|
| PubChem CID | 142511021 |
| Molecular Formula | C33H50N4O |
| Molecular Weight | 518.79 g/mol |
| Exact Mass | 518.40 |
| IUPAC Name | 2-[(2E,7Z)-8,9-dimethylundeca-2,7-dien-2-yl]-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-4-one;(3Z)-3-methylhepta-1,3-diene |
| SMILES | C=C/C(C)=C\CCC.CCC(C)/C(C)=C\CCC/C=C(\C)c1cc(=O)n2cc(N3CCNCC3)ccc2n1 |
| InChI | InChI=1S/C25H36N4O.C8H14/c1-5-19(2)20(3)9-7-6-8-10-21(4)23-17-25(30)29-18-22(11-12-24(29)27-23)28-15-13-26-14-16-28;1-4-6-7-8(3)5-2/h9-12,17-19,26H,5-8,13-16H2,1-4H3;5,7H,2,4,6H2,1,3H3/b20-9-,21-10+;8-7- |
| InChIKey | HENLYZKHBOBVKZ-GMNRAMHDSA-N |
| XLogP | 7.59 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.79 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|