C31H43N3O2 — CID 142511044
(Z)-3,4-dimethylhex-2-ene;7-[1-(2-hydroxyethyl)-3,6-dihydro-2H-pyridin-4-yl]-2-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 142511044) has the molecular formula C31H43N3O2 and a molecular weight of 489.70 g/mol. Its IUPAC name is (Z)-3,4-dimethylhex-2-ene;7-[1-(2-hydroxyethyl)-3,6-dihydro-2H-pyridin-4-yl]-2-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | (Z)-3,4-dimethylhex-2-ene;7-[1-(2-hydroxyethyl)-3,6-dihydro-2H-pyridin-4-yl]-2-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 142511044 |
| Molecular Formula | C31H43N3O2 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.34 |
| IUPAC Name | (Z)-3,4-dimethylhex-2-ene;7-[1-(2-hydroxyethyl)-3,6-dihydro-2H-pyridin-4-yl]-2-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | C/C=C(/C)C(C)CC.C=C(C)/C=C\C(=C/C)c1cc(=O)n2cc(C3=CCN(CCO)CC3)ccc2n1 |
| InChI | InChI=1S/C23H27N3O2.C8H16/c1-4-18(6-5-17(2)3)21-15-23(28)26-16-20(7-8-22(26)24-21)19-9-11-25(12-10-19)13-14-27;1-5-7(3)8(4)6-2/h4-9,15-16,27H,2,10-14H2,1,3H3;5,8H,6H2,1-4H3/b6-5-,18-4+;7-5- |
| InChIKey | DIKVIVLEZMXGPF-ZYXODSDHSA-N |
| XLogP | 6.31 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|