C38H56N4 — CID 142511076
4-cyclobutylidene-7-[(3R)-3-methyl-4-propan-2-ylpiperazin-1-yl]-2-[(3E,5E,10Z)-2,3,11,12-tetramethyltetradeca-1,3,5,10-tetraen-5-yl]pyrido[1,2-a]pyrimidine (PubChem CID 142511076) has the molecular formula C38H56N4 and a molecular weight of 568.89 g/mol. Its IUPAC name is 4-cyclobutylidene-7-[(3R)-3-methyl-4-propan-2-ylpiperazin-1-yl]-2-[(3E,5E,10Z)-2,3,11,12-tetramethyltetradeca-1,3,5,10-tetraen-5-yl]pyrido[1,2-a]pyrimidine.
| Compound Name | 4-cyclobutylidene-7-[(3R)-3-methyl-4-propan-2-ylpiperazin-1-yl]-2-[(3E,5E,10Z)-2,3,11,12-tetramethyltetradeca-1,3,5,10-tetraen-5-yl]pyrido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 142511076 |
| Molecular Formula | C38H56N4 |
| Molecular Weight | 568.89 g/mol |
| Exact Mass | 568.45 |
| IUPAC Name | 4-cyclobutylidene-7-[(3R)-3-methyl-4-propan-2-ylpiperazin-1-yl]-2-[(3E,5E,10Z)-2,3,11,12-tetramethyltetradeca-1,3,5,10-tetraen-5-yl]pyrido[1,2-a]pyrimidine |
| SMILES | C=C(C)/C(C)=C/C(=C\CCC/C=C(/C)C(C)CC)C1=CC(=C2CCC2)N2C=C(N3CCN(C(C)C)[C@H](C)C3)C=CC2=N1 |
| InChI | InChI=1S/C38H56N4/c1-10-29(6)30(7)15-12-11-13-16-34(23-31(8)27(2)3)36-24-37(33-17-14-18-33)42-26-35(19-20-38(42)39-36)40-21-22-41(28(4)5)32(9)25-40/h15-16,19-20,23-24,26,28-29,32H,2,10-14,17-18,21-22,25H2,1,3-9H3/b30-15-,31-23+,34-16+/t29?,32-/m1/s1 |
| InChIKey | XCFSSWFRYCKPRN-XRXVHWETSA-N |
| XLogP | 9.46 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.89 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|