C25H34FN3O3 — CID 142511092
(Z)-3-(3-fluoro-4,5-dimethoxyphenyl)-3-[[(5Z,7E)-3-methyl-7-piperazin-1-ylnona-5,7-dien-4-ylidene]amino]prop-2-enal (PubChem CID 142511092) has the molecular formula C25H34FN3O3 and a molecular weight of 443.56 g/mol. Its IUPAC name is (Z)-3-(3-fluoro-4,5-dimethoxyphenyl)-3-[[(5Z,7E)-3-methyl-7-piperazin-1-ylnona-5,7-dien-4-ylidene]amino]prop-2-enal.
| Compound Name | (Z)-3-(3-fluoro-4,5-dimethoxyphenyl)-3-[[(5Z,7E)-3-methyl-7-piperazin-1-ylnona-5,7-dien-4-ylidene]amino]prop-2-enal |
|---|---|
| PubChem CID | 142511092 |
| Molecular Formula | C25H34FN3O3 |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | (Z)-3-(3-fluoro-4,5-dimethoxyphenyl)-3-[[(5Z,7E)-3-methyl-7-piperazin-1-ylnona-5,7-dien-4-ylidene]amino]prop-2-enal |
| SMILES | C/C=C(\C=C/C(=N/C(=C\C=O)c1cc(F)c(OC)c(OC)c1)C(C)CC)N1CCNCC1 |
| InChI | InChI=1S/C25H34FN3O3/c1-6-18(3)22(9-8-20(7-2)29-13-11-27-12-14-29)28-23(10-15-30)19-16-21(26)25(32-5)24(17-19)31-4/h7-10,15-18,27H,6,11-14H2,1-5H3/b9-8-,20-7+,23-10-,28-22- |
| InChIKey | ZJVUCGQIZYJAFC-DZUSXCJVSA-N |
| XLogP | 4.24 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|